C13H17ClN4O2S — CID 129416500
2-chloro-N-[(2S)-3-methyl-1-(triazol-2-yl)butan-2-yl]benzenesulfonamide (PubChem CID 129416500) has the molecular formula C13H17ClN4O2S and a molecular weight of 328.82 g/mol. Its IUPAC name is 2-chloro-N-[(2S)-3-methyl-1-(triazol-2-yl)butan-2-yl]benzenesulfonamide.
| Compound Name | 2-chloro-N-[(2S)-3-methyl-1-(triazol-2-yl)butan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 129416500 |
| Molecular Formula | C13H17ClN4O2S |
| Molecular Weight | 328.82 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | 2-chloro-N-[(2S)-3-methyl-1-(triazol-2-yl)butan-2-yl]benzenesulfonamide |
| SMILES | CC(C)[C@@H](Cn1nccn1)NS(=O)(=O)c1ccccc1Cl |
| InChI | InChI=1S/C13H17ClN4O2S/c1-10(2)12(9-18-15-7-8-16-18)17-21(19,20)13-6-4-3-5-11(13)14/h3-8,10,12,17H,9H2,1-2H3/t12-/m1/s1 |
| InChIKey | DLVMVRFTSQFORJ-GFCCVEGCSA-N |
| XLogP | 1.93 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.82 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |