C9H11ClN2O2S2 — CID 61124636
2-[(2-chlorophenyl)sulfonylamino]propanethioamide (PubChem CID 61124636) has the molecular formula C9H11ClN2O2S2 and a molecular weight of 278.79 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)sulfonylamino]propanethioamide.
| Compound Name | 2-[(2-chlorophenyl)sulfonylamino]propanethioamide |
|---|---|
| PubChem CID | 61124636 |
| Molecular Formula | C9H11ClN2O2S2 |
| Molecular Weight | 278.79 g/mol |
| Exact Mass | 278.00 |
| IUPAC Name | 2-[(2-chlorophenyl)sulfonylamino]propanethioamide |
| SMILES | CC(NS(=O)(=O)c1ccccc1Cl)C(N)=S |
| InChI | InChI=1S/C9H11ClN2O2S2/c1-6(9(11)15)12-16(13,14)8-5-3-2-4-7(8)10/h2-6,12H,1H3,(H2,11,15) |
| InChIKey | LYWFSLYUMIFFDG-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.79 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|