C14H17ClN2O4S — CID 134349587
3-[(2-chlorophenyl)sulfonylamino]-N-(cyclopropylmethyl)-2-oxobutanamide (PubChem CID 134349587) has the molecular formula C14H17ClN2O4S and a molecular weight of 344.82 g/mol. Its IUPAC name is 3-[(2-chlorophenyl)sulfonylamino]-N-(cyclopropylmethyl)-2-oxobutanamide.
| Compound Name | 3-[(2-chlorophenyl)sulfonylamino]-N-(cyclopropylmethyl)-2-oxobutanamide |
|---|---|
| PubChem CID | 134349587 |
| Molecular Formula | C14H17ClN2O4S |
| Molecular Weight | 344.82 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | 3-[(2-chlorophenyl)sulfonylamino]-N-(cyclopropylmethyl)-2-oxobutanamide |
| SMILES | CC(NS(=O)(=O)c1ccccc1Cl)C(=O)C(=O)NCC1CC1 |
| InChI | InChI=1S/C14H17ClN2O4S/c1-9(13(18)14(19)16-8-10-6-7-10)17-22(20,21)12-5-3-2-4-11(12)15/h2-5,9-10,17H,6-8H2,1H3,(H,16,19) |
| InChIKey | QLPHULGMHFIIEM-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.82 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|