C13H19FN2O5S — CID 100814318
2-[2-fluoro-4-(2-methoxyethylsulfamoyl)phenoxy]-N,N-dimethylacetamide (PubChem CID 100814318) has the molecular formula C13H19FN2O5S and a molecular weight of 334.37 g/mol. Its IUPAC name is 2-[2-fluoro-4-(2-methoxyethylsulfamoyl)phenoxy]-N,N-dimethylacetamide.
| Compound Name | 2-[2-fluoro-4-(2-methoxyethylsulfamoyl)phenoxy]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 100814318 |
| Molecular Formula | C13H19FN2O5S |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 2-[2-fluoro-4-(2-methoxyethylsulfamoyl)phenoxy]-N,N-dimethylacetamide |
| SMILES | COCCNS(=O)(=O)c1ccc(OCC(=O)N(C)C)c(F)c1 |
| InChI | InChI=1S/C13H19FN2O5S/c1-16(2)13(17)9-21-12-5-4-10(8-11(12)14)22(18,19)15-6-7-20-3/h4-5,8,15H,6-7,9H2,1-3H3 |
| InChIKey | MZUKWACNMLDPHJ-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|