C14H20FNO4S — CID 110300909
4-cyclopentyloxy-3-fluoro-N-(2-methoxyethyl)benzenesulfonamide (PubChem CID 110300909) has the molecular formula C14H20FNO4S and a molecular weight of 317.38 g/mol. Its IUPAC name is 4-cyclopentyloxy-3-fluoro-N-(2-methoxyethyl)benzenesulfonamide.
| Compound Name | 4-cyclopentyloxy-3-fluoro-N-(2-methoxyethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 110300909 |
| Molecular Formula | C14H20FNO4S |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | 4-cyclopentyloxy-3-fluoro-N-(2-methoxyethyl)benzenesulfonamide |
| SMILES | COCCNS(=O)(=O)c1ccc(OC2CCCC2)c(F)c1 |
| InChI | InChI=1S/C14H20FNO4S/c1-19-9-8-16-21(17,18)12-6-7-14(13(15)10-12)20-11-4-2-3-5-11/h6-7,10-11,16H,2-5,8-9H2,1H3 |
| InChIKey | JBMCNQKPZGPLGM-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|