C18H25FN2O4S — CID 110312227
4-cyclopentyloxy-3-fluoro-N-(2-oxo-2-piperidin-1-ylethyl)benzenesulfonamide (PubChem CID 110312227) has the molecular formula C18H25FN2O4S and a molecular weight of 384.47 g/mol. Its IUPAC name is 4-cyclopentyloxy-3-fluoro-N-(2-oxo-2-piperidin-1-ylethyl)benzenesulfonamide.
| Compound Name | 4-cyclopentyloxy-3-fluoro-N-(2-oxo-2-piperidin-1-ylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 110312227 |
| Molecular Formula | C18H25FN2O4S |
| Molecular Weight | 384.47 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 4-cyclopentyloxy-3-fluoro-N-(2-oxo-2-piperidin-1-ylethyl)benzenesulfonamide |
| SMILES | O=C(CNS(=O)(=O)c1ccc(OC2CCCC2)c(F)c1)N1CCCCC1 |
| InChI | InChI=1S/C18H25FN2O4S/c19-16-12-15(8-9-17(16)25-14-6-2-3-7-14)26(23,24)20-13-18(22)21-10-4-1-5-11-21/h8-9,12,14,20H,1-7,10-11,13H2 |
| InChIKey | XQHLUXBBTPANKU-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.47 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |