C18H29NO5S2 — CID 142633119
2-[4-[2-(octylsulfonylamino)ethylsulfanyl]phenoxy]acetic acid (PubChem CID 142633119) has the molecular formula C18H29NO5S2 and a molecular weight of 403.57 g/mol. Its IUPAC name is 2-[4-[2-(octylsulfonylamino)ethylsulfanyl]phenoxy]acetic acid.
| Compound Name | 2-[4-[2-(octylsulfonylamino)ethylsulfanyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 142633119 |
| Molecular Formula | C18H29NO5S2 |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | 2-[4-[2-(octylsulfonylamino)ethylsulfanyl]phenoxy]acetic acid |
| SMILES | CCCCCCCCS(=O)(=O)NCCSc1ccc(OCC(=O)O)cc1 |
| InChI | InChI=1S/C18H29NO5S2/c1-2-3-4-5-6-7-14-26(22,23)19-12-13-25-17-10-8-16(9-11-17)24-15-18(20)21/h8-11,19H,2-7,12-15H2,1H3,(H,20,21) |
| InChIKey | HSIDUPHMESNISJ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|