C12H17NO6S — CID 63772703
2-[4-(3-methoxypropylsulfonylamino)phenoxy]acetic acid (PubChem CID 63772703) has the molecular formula C12H17NO6S and a molecular weight of 303.34 g/mol. Its IUPAC name is 2-[4-(3-methoxypropylsulfonylamino)phenoxy]acetic acid.
| Compound Name | 2-[4-(3-methoxypropylsulfonylamino)phenoxy]acetic acid |
|---|---|
| PubChem CID | 63772703 |
| Molecular Formula | C12H17NO6S |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | 2-[4-(3-methoxypropylsulfonylamino)phenoxy]acetic acid |
| SMILES | COCCCS(=O)(=O)Nc1ccc(OCC(=O)O)cc1 |
| InChI | InChI=1S/C12H17NO6S/c1-18-7-2-8-20(16,17)13-10-3-5-11(6-4-10)19-9-12(14)15/h3-6,13H,2,7-9H2,1H3,(H,14,15) |
| InChIKey | IOBHRFKHBVEJCF-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|