C23H31NO10 — CID 89211544
[(2R,3R,4S,5R,6R)-2-[2-(4-acetamidophenoxy)carbonyloxyethoxy]-3-acetyloxy-6-ethyl-5-methyloxan-4-yl] acetate (PubChem CID 89211544) has the molecular formula C23H31NO10 and a molecular weight of 481.50 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-2-[2-(4-acetamidophenoxy)carbonyloxyethoxy]-3-acetyloxy-6-ethyl-5-methyloxan-4-yl] acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-2-[2-(4-acetamidophenoxy)carbonyloxyethoxy]-3-acetyloxy-6-ethyl-5-methyloxan-4-yl] acetate |
|---|---|
| PubChem CID | 89211544 |
| Molecular Formula | C23H31NO10 |
| Molecular Weight | 481.50 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-2-[2-(4-acetamidophenoxy)carbonyloxyethoxy]-3-acetyloxy-6-ethyl-5-methyloxan-4-yl] acetate |
| SMILES | CC[C@H]1O[C@@H](OCCOC(=O)Oc2ccc(NC(C)=O)cc2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1C |
| InChI | InChI=1S/C23H31NO10/c1-6-19-13(2)20(31-15(4)26)21(32-16(5)27)22(34-19)29-11-12-30-23(28)33-18-9-7-17(8-10-18)24-14(3)25/h7-10,13,19-22H,6,11-12H2,1-5H3,(H,24,25)/t13-,19-,20+,21-,22-/m1/s1 |
| InChIKey | XZKACRCIBRPVKU-GAEBTNRBSA-N |
| XLogP | 2.81 |
| TPSA | 135.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.50 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|