C23H33NO10 — CID 118326963
[4,5-diacetyloxy-6-[2-[2-(4-aminophenoxy)ethoxy]ethoxy]-2-ethyloxan-3-yl] acetate (PubChem CID 118326963) has the molecular formula C23H33NO10 and a molecular weight of 483.51 g/mol. Its IUPAC name is [4,5-diacetyloxy-6-[2-[2-(4-aminophenoxy)ethoxy]ethoxy]-2-ethyloxan-3-yl] acetate.
| Compound Name | [4,5-diacetyloxy-6-[2-[2-(4-aminophenoxy)ethoxy]ethoxy]-2-ethyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 118326963 |
| Molecular Formula | C23H33NO10 |
| Molecular Weight | 483.51 g/mol |
| Exact Mass | 483.21 |
| IUPAC Name | [4,5-diacetyloxy-6-[2-[2-(4-aminophenoxy)ethoxy]ethoxy]-2-ethyloxan-3-yl] acetate |
| SMILES | CCC1OC(OCCOCCOc2ccc(N)cc2)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C23H33NO10/c1-5-19-20(31-14(2)25)21(32-15(3)26)22(33-16(4)27)23(34-19)30-13-11-28-10-12-29-18-8-6-17(24)7-9-18/h6-9,19-23H,5,10-13,24H2,1-4H3 |
| InChIKey | YQONYINTKRQNPB-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 141.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.51 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|