C27H32O8 — CID 126575042
[2-[4-(3,5-diacetyloxyphenyl)phenoxy]-6-ethyl-3,5-dimethyloxan-4-yl] acetate (PubChem CID 126575042) has the molecular formula C27H32O8 and a molecular weight of 484.55 g/mol. Its IUPAC name is [2-[4-(3,5-diacetyloxyphenyl)phenoxy]-6-ethyl-3,5-dimethyloxan-4-yl] acetate.
| Compound Name | [2-[4-(3,5-diacetyloxyphenyl)phenoxy]-6-ethyl-3,5-dimethyloxan-4-yl] acetate |
|---|---|
| PubChem CID | 126575042 |
| Molecular Formula | C27H32O8 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | [2-[4-(3,5-diacetyloxyphenyl)phenoxy]-6-ethyl-3,5-dimethyloxan-4-yl] acetate |
| SMILES | CCC1OC(Oc2ccc(-c3cc(OC(C)=O)cc(OC(C)=O)c3)cc2)C(C)C(OC(C)=O)C1C |
| InChI | InChI=1S/C27H32O8/c1-7-25-15(2)26(33-19(6)30)16(3)27(35-25)34-22-10-8-20(9-11-22)21-12-23(31-17(4)28)14-24(13-21)32-18(5)29/h8-16,25-27H,7H2,1-6H3 |
| InChIKey | XFEZBYCJGWPDGS-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|