C21H27NO9 — CID 71261102
3-acetamido-4-[(2S,3R,4S,5R,6R)-3,4-diacetyloxy-6-ethyl-5-methyloxan-2-yl]oxybenzoic acid (PubChem CID 71261102) has the molecular formula C21H27NO9 and a molecular weight of 437.45 g/mol. Its IUPAC name is 3-acetamido-4-[(2S,3R,4S,5R,6R)-3,4-diacetyloxy-6-ethyl-5-methyloxan-2-yl]oxybenzoic acid.
| Compound Name | 3-acetamido-4-[(2S,3R,4S,5R,6R)-3,4-diacetyloxy-6-ethyl-5-methyloxan-2-yl]oxybenzoic acid |
|---|---|
| PubChem CID | 71261102 |
| Molecular Formula | C21H27NO9 |
| Molecular Weight | 437.45 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | 3-acetamido-4-[(2S,3R,4S,5R,6R)-3,4-diacetyloxy-6-ethyl-5-methyloxan-2-yl]oxybenzoic acid |
| SMILES | CC[C@H]1O[C@@H](Oc2ccc(C(=O)O)cc2NC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1C |
| InChI | InChI=1S/C21H27NO9/c1-6-16-10(2)18(28-12(4)24)19(29-13(5)25)21(30-16)31-17-8-7-14(20(26)27)9-15(17)22-11(3)23/h7-10,16,18-19,21H,6H2,1-5H3,(H,22,23)(H,26,27)/t10-,16-,18+,19-,21+/m1/s1 |
| InChIKey | YZZDJZSIUYZGGZ-LKFBTEHJSA-N |
| XLogP | 2.36 |
| TPSA | 137.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.45 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |