C39H43NO15 — CID 121396580
methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[5-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]-2-(hydroxymethyl)phenoxy]oxane-2-carboxylate (PubChem CID 121396580) has the molecular formula C39H43NO15 and a molecular weight of 765.76 g/mol. Its IUPAC name is methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[5-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]-2-(hydroxymethyl)phenoxy]oxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[5-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]-2-(hydroxymethyl)phenoxy]oxane-2-carboxylate |
|---|---|
| PubChem CID | 121396580 |
| Molecular Formula | C39H43NO15 |
| Molecular Weight | 765.76 g/mol |
| Exact Mass | 765.26 |
| IUPAC Name | methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[5-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]-2-(hydroxymethyl)phenoxy]oxane-2-carboxylate |
| SMILES | COC(=O)[C@H]1O[C@@H](Oc2cc(OCCOCCNC(=O)OCC3c4ccccc4-c4ccccc43)ccc2CO)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C39H43NO15/c1-22(42)51-33-34(52-23(2)43)36(53-24(3)44)38(55-35(33)37(45)47-4)54-32-19-26(14-13-25(32)20-41)49-18-17-48-16-15-40-39(46)50-21-31-29-11-7-5-9-27(29)28-10-6-8-12-30(28)31/h5-14,19,31,33-36,38,41H,15-18,20-21H2,1-4H3,(H,40,46)/t33-,34-,35-,36+,38+/m0/s1 |
| InChIKey | SQZYOVWWNBTGIB-WEQPGUHGSA-N |
| XLogP | 3.18 |
| TPSA | 200.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.76 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|