C24H33BN2O14 — CID 169275846
N-[2-[[5-(hydroxymethyl)-2-[(2S,3R,4S,5S,6S)-3,4,5-triacetyloxy-6-methoxycarbonyloxan-2-yl]oxybenzoyl]amino]ethoxy]-methylboronamidic acid (PubChem CID 169275846) has the molecular formula C24H33BN2O14 and a molecular weight of 584.34 g/mol. Its IUPAC name is N-[2-[[5-(hydroxymethyl)-2-[(2S,3R,4S,5S,6S)-3,4,5-triacetyloxy-6-methoxycarbonyloxan-2-yl]oxybenzoyl]amino]ethoxy]-methylboronamidic acid.
| Compound Name | N-[2-[[5-(hydroxymethyl)-2-[(2S,3R,4S,5S,6S)-3,4,5-triacetyloxy-6-methoxycarbonyloxan-2-yl]oxybenzoyl]amino]ethoxy]-methylboronamidic acid |
|---|---|
| PubChem CID | 169275846 |
| Molecular Formula | C24H33BN2O14 |
| Molecular Weight | 584.34 g/mol |
| Exact Mass | 584.20 |
| IUPAC Name | N-[2-[[5-(hydroxymethyl)-2-[(2S,3R,4S,5S,6S)-3,4,5-triacetyloxy-6-methoxycarbonyloxan-2-yl]oxybenzoyl]amino]ethoxy]-methylboronamidic acid |
| SMILES | COC(=O)[C@H]1O[C@@H](Oc2ccc(CO)cc2C(=O)NCCONB(C)O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C24H33BN2O14/c1-12(29)37-18-19(38-13(2)30)21(39-14(3)31)24(41-20(18)23(33)35-5)40-17-7-6-15(11-28)10-16(17)22(32)26-8-9-36-27-25(4)34/h6-7,10,18-21,24,27-28,34H,8-9,11H2,1-5H3,(H,26,32)/t18-,19-,20-,21+,24+/m0/s1 |
| InChIKey | NVJLJVYQGKWSLH-GUJLLPCUSA-N |
| XLogP | -1.39 |
| TPSA | 214.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.34 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|