C20H27NO9 — CID 171561391
methyl 4-acetyloxy-6-[4-(hydroxymethyl)-2-(2-methoxyethylcarbamoyl)phenoxy]oxane-2-carboxylate (PubChem CID 171561391) has the molecular formula C20H27NO9 and a molecular weight of 425.43 g/mol. Its IUPAC name is methyl 4-acetyloxy-6-[4-(hydroxymethyl)-2-(2-methoxyethylcarbamoyl)phenoxy]oxane-2-carboxylate.
| Compound Name | methyl 4-acetyloxy-6-[4-(hydroxymethyl)-2-(2-methoxyethylcarbamoyl)phenoxy]oxane-2-carboxylate |
|---|---|
| PubChem CID | 171561391 |
| Molecular Formula | C20H27NO9 |
| Molecular Weight | 425.43 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | methyl 4-acetyloxy-6-[4-(hydroxymethyl)-2-(2-methoxyethylcarbamoyl)phenoxy]oxane-2-carboxylate |
| SMILES | COCCNC(=O)c1cc(CO)ccc1OC1CC(OC(C)=O)CC(C(=O)OC)O1 |
| InChI | InChI=1S/C20H27NO9/c1-12(23)28-14-9-17(20(25)27-3)30-18(10-14)29-16-5-4-13(11-22)8-15(16)19(24)21-6-7-26-2/h4-5,8,14,17-18,22H,6-7,9-11H2,1-3H3,(H,21,24) |
| InChIKey | YNUPLCVTXGNZOB-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 129.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.43 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|