C17H24ClNO6 — CID 142482618
chloromethane;methyl (2S)-4-acetyloxy-6-(2-amino-4-methylphenoxy)oxane-2-carboxylate (PubChem CID 142482618) has the molecular formula C17H24ClNO6 and a molecular weight of 373.83 g/mol. Its IUPAC name is chloromethane;methyl (2S)-4-acetyloxy-6-(2-amino-4-methylphenoxy)oxane-2-carboxylate.
| Compound Name | chloromethane;methyl (2S)-4-acetyloxy-6-(2-amino-4-methylphenoxy)oxane-2-carboxylate |
|---|---|
| PubChem CID | 142482618 |
| Molecular Formula | C17H24ClNO6 |
| Molecular Weight | 373.83 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | chloromethane;methyl (2S)-4-acetyloxy-6-(2-amino-4-methylphenoxy)oxane-2-carboxylate |
| SMILES | CCl.COC(=O)[C@@H]1CC(OC(C)=O)CC(Oc2ccc(C)cc2N)O1 |
| InChI | InChI=1S/C16H21NO6.CH3Cl/c1-9-4-5-13(12(17)6-9)22-15-8-11(21-10(2)18)7-14(23-15)16(19)20-3;1-2/h4-6,11,14-15H,7-8,17H2,1-3H3;1H3/t11?,14-,15?;/m0./s1 |
| InChIKey | QLJBLDMQDVEOHZ-GEESZHPVSA-N |
| XLogP | 2.42 |
| TPSA | 97.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.83 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|