C18H24N2O7 — CID 142482583
methyl 4-acetyloxy-6-[[2-(methylaminomethyl)phenyl]carbamoyloxy]oxane-2-carboxylate (PubChem CID 142482583) has the molecular formula C18H24N2O7 and a molecular weight of 380.40 g/mol. Its IUPAC name is methyl 4-acetyloxy-6-[[2-(methylaminomethyl)phenyl]carbamoyloxy]oxane-2-carboxylate.
| Compound Name | methyl 4-acetyloxy-6-[[2-(methylaminomethyl)phenyl]carbamoyloxy]oxane-2-carboxylate |
|---|---|
| PubChem CID | 142482583 |
| Molecular Formula | C18H24N2O7 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | methyl 4-acetyloxy-6-[[2-(methylaminomethyl)phenyl]carbamoyloxy]oxane-2-carboxylate |
| SMILES | CNCc1ccccc1NC(=O)OC1CC(OC(C)=O)CC(C(=O)OC)O1 |
| InChI | InChI=1S/C18H24N2O7/c1-11(21)25-13-8-15(17(22)24-3)26-16(9-13)27-18(23)20-14-7-5-4-6-12(14)10-19-2/h4-7,13,15-16,19H,8-10H2,1-3H3,(H,20,23) |
| InChIKey | YNSVBHBQJJYUDP-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|