C40H37N3O14 — CID 162745250
methyl (2S,4S,6S)-4-acetyloxy-6-[2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]-4-[(4-nitrophenoxy)carbonyloxymethyl]phenoxy]oxane-2-carboxylate (PubChem CID 162745250) has the molecular formula C40H37N3O14 and a molecular weight of 783.74 g/mol. Its IUPAC name is methyl (2S,4S,6S)-4-acetyloxy-6-[2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]-4-[(4-nitrophenoxy)carbonyloxymethyl]phenoxy]oxane-2-carboxylate.
| Compound Name | methyl (2S,4S,6S)-4-acetyloxy-6-[2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]-4-[(4-nitrophenoxy)carbonyloxymethyl]phenoxy]oxane-2-carboxylate |
|---|---|
| PubChem CID | 162745250 |
| Molecular Formula | C40H37N3O14 |
| Molecular Weight | 783.74 g/mol |
| Exact Mass | 783.23 |
| IUPAC Name | methyl (2S,4S,6S)-4-acetyloxy-6-[2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]-4-[(4-nitrophenoxy)carbonyloxymethyl]phenoxy]oxane-2-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@H](OC(C)=O)C[C@H](Oc2ccc(COC(=O)Oc3ccc([N+](=O)[O-])cc3)cc2NC(=O)CNC(=O)OCC2c3ccccc3-c3ccccc32)O1 |
| InChI | InChI=1S/C40H37N3O14/c1-23(44)54-27-18-35(38(46)51-2)57-37(19-27)56-34-16-11-24(21-53-40(48)55-26-14-12-25(13-15-26)43(49)50)17-33(34)42-36(45)20-41-39(47)52-22-32-30-9-5-3-7-28(30)29-8-4-6-10-31(29)32/h3-17,27,32,35,37H,18-22H2,1-2H3,(H,41,47)(H,42,45)/t27-,35-,37+/m0/s1 |
| InChIKey | ILSNFRVIUJBMPJ-PPXJGRJFSA-N |
| XLogP | 5.78 |
| TPSA | 217.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.74 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|