C29H35N3O15 — CID 176916959
tert-butyl N-methylcarbamate;methyl 4-acetyloxy-6-[2-nitro-4-[(4-nitrophenoxy)carbonyloxymethyl]phenoxy]oxane-2-carboxylate (PubChem CID 176916959) has the molecular formula C29H35N3O15 and a molecular weight of 665.61 g/mol. Its IUPAC name is tert-butyl N-methylcarbamate;methyl 4-acetyloxy-6-[2-nitro-4-[(4-nitrophenoxy)carbonyloxymethyl]phenoxy]oxane-2-carboxylate.
| Compound Name | tert-butyl N-methylcarbamate;methyl 4-acetyloxy-6-[2-nitro-4-[(4-nitrophenoxy)carbonyloxymethyl]phenoxy]oxane-2-carboxylate |
|---|---|
| PubChem CID | 176916959 |
| Molecular Formula | C29H35N3O15 |
| Molecular Weight | 665.61 g/mol |
| Exact Mass | 665.21 |
| IUPAC Name | tert-butyl N-methylcarbamate;methyl 4-acetyloxy-6-[2-nitro-4-[(4-nitrophenoxy)carbonyloxymethyl]phenoxy]oxane-2-carboxylate |
| SMILES | CNC(=O)OC(C)(C)C.COC(=O)C1CC(OC(C)=O)CC(Oc2ccc(COC(=O)Oc3ccc([N+](=O)[O-])cc3)cc2[N+](=O)[O-])O1 |
| InChI | InChI=1S/C23H22N2O13.C6H13NO2/c1-13(26)35-17-10-20(22(27)33-2)38-21(11-17)37-19-8-3-14(9-18(19)25(31)32)12-34-23(28)36-16-6-4-15(5-7-16)24(29)30;1-6(2,3)9-5(8)7-4/h3-9,17,20-21H,10-12H2,1-2H3;1-4H3,(H,7,8) |
| InChIKey | MXHQMOJEAZFAFB-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 231.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.61 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|