C27H28N2O15 — CID 163614121
[(2R,3R,4R,6S)-3,4-diacetyloxy-6-[2-nitro-4-[2-(4-nitrophenoxy)carbonyloxyethyl]phenoxy]oxan-2-yl]methyl acetate (PubChem CID 163614121) has the molecular formula C27H28N2O15 and a molecular weight of 620.52 g/mol. Its IUPAC name is [(2R,3R,4R,6S)-3,4-diacetyloxy-6-[2-nitro-4-[2-(4-nitrophenoxy)carbonyloxyethyl]phenoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,6S)-3,4-diacetyloxy-6-[2-nitro-4-[2-(4-nitrophenoxy)carbonyloxyethyl]phenoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 163614121 |
| Molecular Formula | C27H28N2O15 |
| Molecular Weight | 620.52 g/mol |
| Exact Mass | 620.15 |
| IUPAC Name | [(2R,3R,4R,6S)-3,4-diacetyloxy-6-[2-nitro-4-[2-(4-nitrophenoxy)carbonyloxyethyl]phenoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](Oc2ccc(CCOC(=O)Oc3ccc([N+](=O)[O-])cc3)cc2[N+](=O)[O-])C[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C27H28N2O15/c1-15(30)39-14-24-26(41-17(3)32)23(40-16(2)31)13-25(44-24)43-22-9-4-18(12-21(22)29(36)37)10-11-38-27(33)42-20-7-5-19(6-8-20)28(34)35/h4-9,12,23-26H,10-11,13-14H2,1-3H3/t23-,24-,25-,26-/m1/s1 |
| InChIKey | HINDTNKDAGTJHG-VEYUFSJPSA-N |
| XLogP | 3.18 |
| TPSA | 219.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.52 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|