C28H28N2O16 — CID 54181150
[(2R,3S,4R,5S,6R)-3,4,5-triacetyloxy-6-[4-nitro-2-[(4-nitrophenoxy)carbonyloxymethyl]phenyl]oxan-2-yl]methyl acetate (PubChem CID 54181150) has the molecular formula C28H28N2O16 and a molecular weight of 648.53 g/mol. Its IUPAC name is [(2R,3S,4R,5S,6R)-3,4,5-triacetyloxy-6-[4-nitro-2-[(4-nitrophenoxy)carbonyloxymethyl]phenyl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5S,6R)-3,4,5-triacetyloxy-6-[4-nitro-2-[(4-nitrophenoxy)carbonyloxymethyl]phenyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 54181150 |
| Molecular Formula | C28H28N2O16 |
| Molecular Weight | 648.53 g/mol |
| Exact Mass | 648.14 |
| IUPAC Name | [(2R,3S,4R,5S,6R)-3,4,5-triacetyloxy-6-[4-nitro-2-[(4-nitrophenoxy)carbonyloxymethyl]phenyl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](c2ccc([N+](=O)[O-])cc2COC(=O)Oc2ccc([N+](=O)[O-])cc2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C28H28N2O16/c1-14(31)40-13-23-25(42-15(2)32)27(44-17(4)34)26(43-16(3)33)24(46-23)22-10-7-20(30(38)39)11-18(22)12-41-28(35)45-21-8-5-19(6-9-21)29(36)37/h5-11,23-27H,12-13H2,1-4H3/t23-,24-,25+,26+,27+/m1/s1 |
| InChIKey | PBWRZWPHCDKWTK-VKINHPFQSA-N |
| XLogP | 3.02 |
| TPSA | 236.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.53 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|