C20H28N2O9 — CID 145416026
methyl (2S,4S,6S)-4-acetyloxy-6-[5-[2-(2-aminoethoxy)ethoxy]-2-carbamoylphenoxy]oxane-2-carboxylate (PubChem CID 145416026) has the molecular formula C20H28N2O9 and a molecular weight of 440.45 g/mol. Its IUPAC name is methyl (2S,4S,6S)-4-acetyloxy-6-[5-[2-(2-aminoethoxy)ethoxy]-2-carbamoylphenoxy]oxane-2-carboxylate.
| Compound Name | methyl (2S,4S,6S)-4-acetyloxy-6-[5-[2-(2-aminoethoxy)ethoxy]-2-carbamoylphenoxy]oxane-2-carboxylate |
|---|---|
| PubChem CID | 145416026 |
| Molecular Formula | C20H28N2O9 |
| Molecular Weight | 440.45 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | methyl (2S,4S,6S)-4-acetyloxy-6-[5-[2-(2-aminoethoxy)ethoxy]-2-carbamoylphenoxy]oxane-2-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@H](OC(C)=O)C[C@H](Oc2cc(OCCOCCN)ccc2C(N)=O)O1 |
| InChI | InChI=1S/C20H28N2O9/c1-12(23)29-14-10-17(20(25)26-2)31-18(11-14)30-16-9-13(3-4-15(16)19(22)24)28-8-7-27-6-5-21/h3-4,9,14,17-18H,5-8,10-11,21H2,1-2H3,(H2,22,24)/t14-,17-,18+/m0/s1 |
| InChIKey | XTNCCAPTVHKLBT-JCGIZDLHSA-N |
| XLogP | 0.13 |
| TPSA | 158.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.45 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|