C22H26ClNO11 — CID 135324152
methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-[carbonochloridoyl(methyl)amino]-4-methylphenoxy]oxane-2-carboxylate (PubChem CID 135324152) has the molecular formula C22H26ClNO11 and a molecular weight of 515.90 g/mol. Its IUPAC name is methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-[carbonochloridoyl(methyl)amino]-4-methylphenoxy]oxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-[carbonochloridoyl(methyl)amino]-4-methylphenoxy]oxane-2-carboxylate |
|---|---|
| PubChem CID | 135324152 |
| Molecular Formula | C22H26ClNO11 |
| Molecular Weight | 515.90 g/mol |
| Exact Mass | 515.12 |
| IUPAC Name | methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-[carbonochloridoyl(methyl)amino]-4-methylphenoxy]oxane-2-carboxylate |
| SMILES | COC(=O)[C@H]1O[C@@H](Oc2ccc(C)cc2N(C)C(=O)Cl)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C22H26ClNO11/c1-10-7-8-15(14(9-10)24(5)22(23)29)34-21-19(33-13(4)27)17(32-12(3)26)16(31-11(2)25)18(35-21)20(28)30-6/h7-9,16-19,21H,1-6H3/t16-,17-,18-,19+,21+/m0/s1 |
| InChIKey | TYGQVKUNECRCNA-VDRZXAFZSA-N |
| XLogP | 1.86 |
| TPSA | 143.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.90 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|