C19H25NO8 — CID 145318585
2-methylpropyl 4-acetyloxy-6-[4-(hydroxymethyl)-2-nitrosophenoxy]oxane-2-carboxylate (PubChem CID 145318585) has the molecular formula C19H25NO8 and a molecular weight of 395.41 g/mol. Its IUPAC name is 2-methylpropyl 4-acetyloxy-6-[4-(hydroxymethyl)-2-nitrosophenoxy]oxane-2-carboxylate.
| Compound Name | 2-methylpropyl 4-acetyloxy-6-[4-(hydroxymethyl)-2-nitrosophenoxy]oxane-2-carboxylate |
|---|---|
| PubChem CID | 145318585 |
| Molecular Formula | C19H25NO8 |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 2-methylpropyl 4-acetyloxy-6-[4-(hydroxymethyl)-2-nitrosophenoxy]oxane-2-carboxylate |
| SMILES | CC(=O)OC1CC(Oc2ccc(CO)cc2N=O)OC(C(=O)OCC(C)C)C1 |
| InChI | InChI=1S/C19H25NO8/c1-11(2)10-25-19(23)17-7-14(26-12(3)22)8-18(28-17)27-16-5-4-13(9-21)6-15(16)20-24/h4-6,11,14,17-18,21H,7-10H2,1-3H3 |
| InChIKey | KGKGKKMRCIRUCE-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 120.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |