C17H22O6 — CID 178003313
[2-ethyl-6-[2-formyl-4-(hydroxymethyl)phenoxy]oxan-4-yl] acetate (PubChem CID 178003313) has the molecular formula C17H22O6 and a molecular weight of 322.36 g/mol. Its IUPAC name is [2-ethyl-6-[2-formyl-4-(hydroxymethyl)phenoxy]oxan-4-yl] acetate.
| Compound Name | [2-ethyl-6-[2-formyl-4-(hydroxymethyl)phenoxy]oxan-4-yl] acetate |
|---|---|
| PubChem CID | 178003313 |
| Molecular Formula | C17H22O6 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | [2-ethyl-6-[2-formyl-4-(hydroxymethyl)phenoxy]oxan-4-yl] acetate |
| SMILES | CCC1CC(OC(C)=O)CC(Oc2ccc(CO)cc2C=O)O1 |
| InChI | InChI=1S/C17H22O6/c1-3-14-7-15(21-11(2)20)8-17(22-14)23-16-5-4-12(9-18)6-13(16)10-19/h4-6,10,14-15,17-18H,3,7-9H2,1-2H3 |
| InChIKey | MAZFDDCOGDUQIB-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|