C20H30N2O9 — CID 178003106
6-[2-[2-[2-(2-aminoethoxy)ethoxy]ethylcarbamoyl]-4-(hydroxymethyl)phenoxy]-4-hydroxyoxane-2-carboxylic acid (PubChem CID 178003106) has the molecular formula C20H30N2O9 and a molecular weight of 442.47 g/mol. Its IUPAC name is 6-[2-[2-[2-(2-aminoethoxy)ethoxy]ethylcarbamoyl]-4-(hydroxymethyl)phenoxy]-4-hydroxyoxane-2-carboxylic acid.
| Compound Name | 6-[2-[2-[2-(2-aminoethoxy)ethoxy]ethylcarbamoyl]-4-(hydroxymethyl)phenoxy]-4-hydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 178003106 |
| Molecular Formula | C20H30N2O9 |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | 6-[2-[2-[2-(2-aminoethoxy)ethoxy]ethylcarbamoyl]-4-(hydroxymethyl)phenoxy]-4-hydroxyoxane-2-carboxylic acid |
| SMILES | NCCOCCOCCNC(=O)c1cc(CO)ccc1OC1CC(O)CC(C(=O)O)O1 |
| InChI | InChI=1S/C20H30N2O9/c21-3-5-28-7-8-29-6-4-22-19(25)15-9-13(12-23)1-2-16(15)30-18-11-14(24)10-17(31-18)20(26)27/h1-2,9,14,17-18,23-24H,3-8,10-12,21H2,(H,22,25)(H,26,27) |
| InChIKey | GZHWDRRUNBOMLB-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 169.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|