C23H40N2O10 — CID 171561437
6-[2-formyl-4-(methoxymethyl)phenoxy]-4-hydroxyoxane-2-carboxylic acid;methanol;2-[2-[2-(methylamino)ethoxy]ethoxy]ethanamine (PubChem CID 171561437) has the molecular formula C23H40N2O10 and a molecular weight of 504.58 g/mol. Its IUPAC name is 6-[2-formyl-4-(methoxymethyl)phenoxy]-4-hydroxyoxane-2-carboxylic acid;methanol;2-[2-[2-(methylamino)ethoxy]ethoxy]ethanamine.
| Compound Name | 6-[2-formyl-4-(methoxymethyl)phenoxy]-4-hydroxyoxane-2-carboxylic acid;methanol;2-[2-[2-(methylamino)ethoxy]ethoxy]ethanamine |
|---|---|
| PubChem CID | 171561437 |
| Molecular Formula | C23H40N2O10 |
| Molecular Weight | 504.58 g/mol |
| Exact Mass | 504.27 |
| IUPAC Name | 6-[2-formyl-4-(methoxymethyl)phenoxy]-4-hydroxyoxane-2-carboxylic acid;methanol;2-[2-[2-(methylamino)ethoxy]ethoxy]ethanamine |
| SMILES | CNCCOCCOCCN.CO.COCc1ccc(OC2CC(O)CC(C(=O)O)O2)c(C=O)c1 |
| InChI | InChI=1S/C15H18O7.C7H18N2O2.CH4O/c1-20-8-9-2-3-12(10(4-9)7-16)21-14-6-11(17)5-13(22-14)15(18)19;1-9-3-5-11-7-6-10-4-2-8;1-2/h2-4,7,11,13-14,17H,5-6,8H2,1H3,(H,18,19);9H,2-8H2,1H3;2H,1H3 |
| InChIKey | XFTWPCGVNGZAGL-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 179.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.58 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|