C32H40N2O15 — CID 178003351
6-[4-[[2,4-bis(formyloxymethyl)phenyl]carbamoyloxymethyl]-2-[2-[2-(2-methoxyethoxy)ethoxy]ethylcarbamoyl]phenoxy]-4-hydroxyoxane-2-carboxylic acid (PubChem CID 178003351) has the molecular formula C32H40N2O15 and a molecular weight of 692.67 g/mol. Its IUPAC name is 6-[4-[[2,4-bis(formyloxymethyl)phenyl]carbamoyloxymethyl]-2-[2-[2-(2-methoxyethoxy)ethoxy]ethylcarbamoyl]phenoxy]-4-hydroxyoxane-2-carboxylic acid.
| Compound Name | 6-[4-[[2,4-bis(formyloxymethyl)phenyl]carbamoyloxymethyl]-2-[2-[2-(2-methoxyethoxy)ethoxy]ethylcarbamoyl]phenoxy]-4-hydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 178003351 |
| Molecular Formula | C32H40N2O15 |
| Molecular Weight | 692.67 g/mol |
| Exact Mass | 692.24 |
| IUPAC Name | 6-[4-[[2,4-bis(formyloxymethyl)phenyl]carbamoyloxymethyl]-2-[2-[2-(2-methoxyethoxy)ethoxy]ethylcarbamoyl]phenoxy]-4-hydroxyoxane-2-carboxylic acid |
| SMILES | COCCOCCOCCNC(=O)c1cc(COC(=O)Nc2ccc(COC=O)cc2COC=O)ccc1OC1CC(O)CC(C(=O)O)O1 |
| InChI | InChI=1S/C32H40N2O15/c1-42-8-9-44-11-10-43-7-6-33-30(38)25-13-22(3-5-27(25)48-29-15-24(37)14-28(49-29)31(39)40)17-47-32(41)34-26-4-2-21(16-45-19-35)12-23(26)18-46-20-36/h2-5,12-13,19-20,24,28-29,37H,6-11,14-18H2,1H3,(H,33,38)(H,34,41)(H,39,40) |
| InChIKey | NCGZYZFNHKPGCP-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 223.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.67 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|