C32H47N3O11 — CID 166154343
6-[4-(acetyloxymethyl)-2-[2-[6-[(3,3-dimethyl-5-oxopentanoyl)-methylamino]hexanoylamino]ethylcarbamoyl]phenoxy]-4-hydroxyoxane-2-carboxylic acid (PubChem CID 166154343) has the molecular formula C32H47N3O11 and a molecular weight of 649.74 g/mol. Its IUPAC name is 6-[4-(acetyloxymethyl)-2-[2-[6-[(3,3-dimethyl-5-oxopentanoyl)-methylamino]hexanoylamino]ethylcarbamoyl]phenoxy]-4-hydroxyoxane-2-carboxylic acid.
| Compound Name | 6-[4-(acetyloxymethyl)-2-[2-[6-[(3,3-dimethyl-5-oxopentanoyl)-methylamino]hexanoylamino]ethylcarbamoyl]phenoxy]-4-hydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 166154343 |
| Molecular Formula | C32H47N3O11 |
| Molecular Weight | 649.74 g/mol |
| Exact Mass | 649.32 |
| IUPAC Name | 6-[4-(acetyloxymethyl)-2-[2-[6-[(3,3-dimethyl-5-oxopentanoyl)-methylamino]hexanoylamino]ethylcarbamoyl]phenoxy]-4-hydroxyoxane-2-carboxylic acid |
| SMILES | CC(=O)OCc1ccc(OC2CC(O)CC(C(=O)O)O2)c(C(=O)NCCNC(=O)CCCCCN(C)C(=O)CC(C)(C)CC=O)c1 |
| InChI | InChI=1S/C32H47N3O11/c1-21(37)44-20-22-9-10-25(45-29-18-23(38)17-26(46-29)31(42)43)24(16-22)30(41)34-13-12-33-27(39)8-6-5-7-14-35(4)28(40)19-32(2,3)11-15-36/h9-10,15-16,23,26,29,38H,5-8,11-14,17-20H2,1-4H3,(H,33,39)(H,34,41)(H,42,43) |
| InChIKey | VKSRHYFJNRQUNQ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 197.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.74 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|