C25H37NO10 — CID 167244900
(2S,4S,6S)-6-[4-(acetyloxymethyl)-3-[2-[2-(hexanoylamino)ethoxy]ethoxy]phenoxy]-4-hydroxyoxane-2-carboxylic acid (PubChem CID 167244900) has the molecular formula C25H37NO10 and a molecular weight of 511.57 g/mol. Its IUPAC name is (2S,4S,6S)-6-[4-(acetyloxymethyl)-3-[2-[2-(hexanoylamino)ethoxy]ethoxy]phenoxy]-4-hydroxyoxane-2-carboxylic acid.
| Compound Name | (2S,4S,6S)-6-[4-(acetyloxymethyl)-3-[2-[2-(hexanoylamino)ethoxy]ethoxy]phenoxy]-4-hydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 167244900 |
| Molecular Formula | C25H37NO10 |
| Molecular Weight | 511.57 g/mol |
| Exact Mass | 511.24 |
| IUPAC Name | (2S,4S,6S)-6-[4-(acetyloxymethyl)-3-[2-[2-(hexanoylamino)ethoxy]ethoxy]phenoxy]-4-hydroxyoxane-2-carboxylic acid |
| SMILES | CCCCCC(=O)NCCOCCOc1cc(O[C@H]2C[C@@H](O)C[C@@H](C(=O)O)O2)ccc1COC(C)=O |
| InChI | InChI=1S/C25H37NO10/c1-3-4-5-6-23(29)26-9-10-32-11-12-33-21-15-20(8-7-18(21)16-34-17(2)27)35-24-14-19(28)13-22(36-24)25(30)31/h7-8,15,19,22,24,28H,3-6,9-14,16H2,1-2H3,(H,26,29)(H,30,31)/t19-,22-,24+/m0/s1 |
| InChIKey | DPQLTUJCOPGCFL-NGYIFUPDSA-N |
| XLogP | 2.17 |
| TPSA | 149.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.57 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|