C31H44N4O15S — CID 166923468
6-[4-(carbamoyloxymethyl)-3-[3-[[2-[6-[methyl-[(Z)-4-oxobut-2-enoyl]amino]hexanoylamino]-3-sulfopropanoyl]amino]propoxy]phenoxy]-4-hydroxyoxane-2-carboxylic acid (PubChem CID 166923468) has the molecular formula C31H44N4O15S and a molecular weight of 744.77 g/mol. Its IUPAC name is 6-[4-(carbamoyloxymethyl)-3-[3-[[2-[6-[methyl-[(Z)-4-oxobut-2-enoyl]amino]hexanoylamino]-3-sulfopropanoyl]amino]propoxy]phenoxy]-4-hydroxyoxane-2-carboxylic acid.
| Compound Name | 6-[4-(carbamoyloxymethyl)-3-[3-[[2-[6-[methyl-[(Z)-4-oxobut-2-enoyl]amino]hexanoylamino]-3-sulfopropanoyl]amino]propoxy]phenoxy]-4-hydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 166923468 |
| Molecular Formula | C31H44N4O15S |
| Molecular Weight | 744.77 g/mol |
| Exact Mass | 744.25 |
| IUPAC Name | 6-[4-(carbamoyloxymethyl)-3-[3-[[2-[6-[methyl-[(Z)-4-oxobut-2-enoyl]amino]hexanoylamino]-3-sulfopropanoyl]amino]propoxy]phenoxy]-4-hydroxyoxane-2-carboxylic acid |
| SMILES | CN(CCCCCC(=O)NC(CS(=O)(=O)O)C(=O)NCCCOc1cc(OC2CC(O)CC(C(=O)O)O2)ccc1COC(N)=O)C(=O)/C=C\C=O |
| InChI | InChI=1S/C31H44N4O15S/c1-35(27(39)8-5-13-36)12-4-2-3-7-26(38)34-23(19-51(44,45)46)29(40)33-11-6-14-47-24-17-22(10-9-20(24)18-48-31(32)43)49-28-16-21(37)15-25(50-28)30(41)42/h5,8-10,13,17,21,23,25,28,37H,2-4,6-7,11-12,14-16,18-19H2,1H3,(H2,32,43)(H,33,40)(H,34,38)(H,41,42)(H,44,45,46)/b8-5- |
| InChIKey | URYGGGQZBKRQPI-YVMONPNESA-N |
| XLogP | -0.36 |
| TPSA | 287.49 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.77 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|