C28H35N3O16S — CID 146428303
6-[4-(acetyloxymethyl)-3-[2-[2-[[2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]-3-sulfopropanoyl]amino]ethoxy]ethoxy]phenoxy]-4-hydroxyoxane-2-carboxylic acid (PubChem CID 146428303) has the molecular formula C28H35N3O16S and a molecular weight of 701.66 g/mol. Its IUPAC name is 6-[4-(acetyloxymethyl)-3-[2-[2-[[2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]-3-sulfopropanoyl]amino]ethoxy]ethoxy]phenoxy]-4-hydroxyoxane-2-carboxylic acid.
| Compound Name | 6-[4-(acetyloxymethyl)-3-[2-[2-[[2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]-3-sulfopropanoyl]amino]ethoxy]ethoxy]phenoxy]-4-hydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 146428303 |
| Molecular Formula | C28H35N3O16S |
| Molecular Weight | 701.66 g/mol |
| Exact Mass | 701.17 |
| IUPAC Name | 6-[4-(acetyloxymethyl)-3-[2-[2-[[2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]-3-sulfopropanoyl]amino]ethoxy]ethoxy]phenoxy]-4-hydroxyoxane-2-carboxylic acid |
| SMILES | CC(=O)OCc1ccc(OC2CC(O)CC(C(=O)O)O2)cc1OCCOCCNC(=O)C(CS(=O)(=O)O)NC(=O)CN1C(=O)C=CC1=O |
| InChI | InChI=1S/C28H35N3O16S/c1-16(32)45-14-17-2-3-19(46-26-11-18(33)10-22(47-26)28(38)39)12-21(17)44-9-8-43-7-6-29-27(37)20(15-48(40,41)42)30-23(34)13-31-24(35)4-5-25(31)36/h2-5,12,18,20,22,26,33H,6-11,13-15H2,1H3,(H,29,37)(H,30,34)(H,38,39)(H,40,41,42) |
| InChIKey | YYYBIZRQEZEJQO-UHFFFAOYSA-N |
| XLogP | -2.11 |
| TPSA | 270.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.66 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|