C33H47N3O16S — CID 145098407
acetylene;6-[2-(acetyloxymethyl)-5-[2-[2-[[2-[3-(2,5-dioxopyrrolidin-1-yl)propanoylamino]-3-sulfopropanoyl]amino]ethoxy]ethoxy]phenoxy]-4-hydroxyoxane-2-carboxylic acid;ethane (PubChem CID 145098407) has the molecular formula C33H47N3O16S and a molecular weight of 773.81 g/mol. Its IUPAC name is acetylene;6-[2-(acetyloxymethyl)-5-[2-[2-[[2-[3-(2,5-dioxopyrrolidin-1-yl)propanoylamino]-3-sulfopropanoyl]amino]ethoxy]ethoxy]phenoxy]-4-hydroxyoxane-2-carboxylic acid;ethane.
| Compound Name | acetylene;6-[2-(acetyloxymethyl)-5-[2-[2-[[2-[3-(2,5-dioxopyrrolidin-1-yl)propanoylamino]-3-sulfopropanoyl]amino]ethoxy]ethoxy]phenoxy]-4-hydroxyoxane-2-carboxylic acid;ethane |
|---|---|
| PubChem CID | 145098407 |
| Molecular Formula | C33H47N3O16S |
| Molecular Weight | 773.81 g/mol |
| Exact Mass | 773.27 |
| IUPAC Name | acetylene;6-[2-(acetyloxymethyl)-5-[2-[2-[[2-[3-(2,5-dioxopyrrolidin-1-yl)propanoylamino]-3-sulfopropanoyl]amino]ethoxy]ethoxy]phenoxy]-4-hydroxyoxane-2-carboxylic acid;ethane |
| SMILES | C#C.CC.CC(=O)OCc1ccc(OCCOCCNC(=O)C(CS(=O)(=O)O)NC(=O)CCN2C(=O)CCC2=O)cc1OC1CC(O)CC(C(=O)O)O1 |
| InChI | InChI=1S/C29H39N3O16S.C2H6.C2H2/c1-17(33)46-15-18-2-3-20(14-22(18)47-27-13-19(34)12-23(48-27)29(39)40)45-11-10-44-9-7-30-28(38)21(16-49(41,42)43)31-24(35)6-8-32-25(36)4-5-26(32)37;2*1-2/h2-3,14,19,21,23,27,34H,4-13,15-16H2,1H3,(H,30,38)(H,31,35)(H,39,40)(H,41,42,43);1-2H3;1-2H |
| InChIKey | AJLVORBCOJXVIL-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 270.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.81 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|