C29H38N4O16S — CID 166966452
6-[3-[2-[2-[[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-3-sulfopropanoyl]amino]ethoxy]ethoxy]-4-(methylcarbamoyloxymethyl)phenoxy]-4-hydroxyoxane-2-carboxylic acid (PubChem CID 166966452) has the molecular formula C29H38N4O16S and a molecular weight of 730.70 g/mol. Its IUPAC name is 6-[3-[2-[2-[[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-3-sulfopropanoyl]amino]ethoxy]ethoxy]-4-(methylcarbamoyloxymethyl)phenoxy]-4-hydroxyoxane-2-carboxylic acid.
| Compound Name | 6-[3-[2-[2-[[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-3-sulfopropanoyl]amino]ethoxy]ethoxy]-4-(methylcarbamoyloxymethyl)phenoxy]-4-hydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 166966452 |
| Molecular Formula | C29H38N4O16S |
| Molecular Weight | 730.70 g/mol |
| Exact Mass | 730.20 |
| IUPAC Name | 6-[3-[2-[2-[[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-3-sulfopropanoyl]amino]ethoxy]ethoxy]-4-(methylcarbamoyloxymethyl)phenoxy]-4-hydroxyoxane-2-carboxylic acid |
| SMILES | CNC(=O)OCc1ccc(OC2CC(O)CC(C(=O)O)O2)cc1OCCOCCNC(=O)C(CS(=O)(=O)O)NC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C29H38N4O16S/c1-30-29(41)47-15-17-2-3-19(48-26-13-18(34)12-22(49-26)28(39)40)14-21(17)46-11-10-45-9-7-31-27(38)20(16-50(42,43)44)32-23(35)6-8-33-24(36)4-5-25(33)37/h2-5,14,18,20,22,26,34H,6-13,15-16H2,1H3,(H,30,41)(H,31,38)(H,32,35)(H,39,40)(H,42,43,44) |
| InChIKey | BETGZNPMCANOOQ-UHFFFAOYSA-N |
| XLogP | -1.93 |
| TPSA | 282.73 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.70 |
| LogP ≤ 5 | -1.93 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|