C20H29NO10 — CID 166778062
(2S,3S)-6-[4-(acetyloxymethyl)-3-[2-[2-(methylamino)ethoxy]ethoxy]phenoxy]-3,4-dihydroxyoxane-2-carboxylic acid (PubChem CID 166778062) has the molecular formula C20H29NO10 and a molecular weight of 443.45 g/mol. Its IUPAC name is (2S,3S)-6-[4-(acetyloxymethyl)-3-[2-[2-(methylamino)ethoxy]ethoxy]phenoxy]-3,4-dihydroxyoxane-2-carboxylic acid.
| Compound Name | (2S,3S)-6-[4-(acetyloxymethyl)-3-[2-[2-(methylamino)ethoxy]ethoxy]phenoxy]-3,4-dihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 166778062 |
| Molecular Formula | C20H29NO10 |
| Molecular Weight | 443.45 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | (2S,3S)-6-[4-(acetyloxymethyl)-3-[2-[2-(methylamino)ethoxy]ethoxy]phenoxy]-3,4-dihydroxyoxane-2-carboxylic acid |
| SMILES | CNCCOCCOc1cc(OC2CC(O)[C@H](O)[C@@H](C(=O)O)O2)ccc1COC(C)=O |
| InChI | InChI=1S/C20H29NO10/c1-12(22)29-11-13-3-4-14(9-16(13)28-8-7-27-6-5-21-2)30-17-10-15(23)18(24)19(31-17)20(25)26/h3-4,9,15,17-19,21,23-24H,5-8,10-11H2,1-2H3,(H,25,26)/t15?,17?,18-,19-/m0/s1 |
| InChIKey | IVUWPGAXSQPHJN-FYOYPEGLSA-N |
| XLogP | -0.34 |
| TPSA | 153.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.45 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|