C30H42N2O10 — CID 145098359
6-[4-[4-[3-[[(Z)-but-2-enoyl]-formylamino]propanoylamino]butyl]-2-(2,2-dimethylpropanoyloxymethyl)phenoxy]-4-hydroxyoxane-2-carboxylic acid (PubChem CID 145098359) has the molecular formula C30H42N2O10 and a molecular weight of 590.67 g/mol. Its IUPAC name is 6-[4-[4-[3-[[(Z)-but-2-enoyl]-formylamino]propanoylamino]butyl]-2-(2,2-dimethylpropanoyloxymethyl)phenoxy]-4-hydroxyoxane-2-carboxylic acid.
| Compound Name | 6-[4-[4-[3-[[(Z)-but-2-enoyl]-formylamino]propanoylamino]butyl]-2-(2,2-dimethylpropanoyloxymethyl)phenoxy]-4-hydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 145098359 |
| Molecular Formula | C30H42N2O10 |
| Molecular Weight | 590.67 g/mol |
| Exact Mass | 590.28 |
| IUPAC Name | 6-[4-[4-[3-[[(Z)-but-2-enoyl]-formylamino]propanoylamino]butyl]-2-(2,2-dimethylpropanoyloxymethyl)phenoxy]-4-hydroxyoxane-2-carboxylic acid |
| SMILES | C/C=C\C(=O)N(C=O)CCC(=O)NCCCCc1ccc(OC2CC(O)CC(C(=O)O)O2)c(COC(=O)C(C)(C)C)c1 |
| InChI | InChI=1S/C30H42N2O10/c1-5-8-26(36)32(19-33)14-12-25(35)31-13-7-6-9-20-10-11-23(21(15-20)18-40-29(39)30(2,3)4)41-27-17-22(34)16-24(42-27)28(37)38/h5,8,10-11,15,19,22,24,27,34H,6-7,9,12-14,16-18H2,1-4H3,(H,31,35)(H,37,38)/b8-5- |
| InChIKey | UXKNZQBDJRMBSG-YVMONPNESA-N |
| XLogP | 2.50 |
| TPSA | 168.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.67 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|