C25H30N2O9 — CID 145416672
[5-[4-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]butyl]-2-(6-formyl-4-hydroxyoxan-2-yl)oxyphenyl]methyl formate (PubChem CID 145416672) has the molecular formula C25H30N2O9 and a molecular weight of 502.52 g/mol. Its IUPAC name is [5-[4-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]butyl]-2-(6-formyl-4-hydroxyoxan-2-yl)oxyphenyl]methyl formate.
| Compound Name | [5-[4-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]butyl]-2-(6-formyl-4-hydroxyoxan-2-yl)oxyphenyl]methyl formate |
|---|---|
| PubChem CID | 145416672 |
| Molecular Formula | C25H30N2O9 |
| Molecular Weight | 502.52 g/mol |
| Exact Mass | 502.20 |
| IUPAC Name | [5-[4-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]butyl]-2-(6-formyl-4-hydroxyoxan-2-yl)oxyphenyl]methyl formate |
| SMILES | O=COCc1cc(CCCCNC(=O)CCN2C(=O)C=CC2=O)ccc1OC1CC(O)CC(C=O)O1 |
| InChI | InChI=1S/C25H30N2O9/c28-14-20-12-19(30)13-25(35-20)36-21-5-4-17(11-18(21)15-34-16-29)3-1-2-9-26-22(31)8-10-27-23(32)6-7-24(27)33/h4-7,11,14,16,19-20,25,30H,1-3,8-10,12-13,15H2,(H,26,31) |
| InChIKey | JNUCAFURBPHMOO-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 148.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.52 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|