C28H42N4O12 — CID 144831446
(2S,4S,6S)-6-[2-[3-[[2-amino-6-[(3-hydroxy-2,2-dimethylpropanoyl)amino]hexanoyl]amino]propanoylamino]-4-(carboxyoxymethyl)phenoxy]-4-hydroxyoxane-2-carboxylic acid (PubChem CID 144831446) has the molecular formula C28H42N4O12 and a molecular weight of 626.66 g/mol. Its IUPAC name is (2S,4S,6S)-6-[2-[3-[[2-amino-6-[(3-hydroxy-2,2-dimethylpropanoyl)amino]hexanoyl]amino]propanoylamino]-4-(carboxyoxymethyl)phenoxy]-4-hydroxyoxane-2-carboxylic acid.
| Compound Name | (2S,4S,6S)-6-[2-[3-[[2-amino-6-[(3-hydroxy-2,2-dimethylpropanoyl)amino]hexanoyl]amino]propanoylamino]-4-(carboxyoxymethyl)phenoxy]-4-hydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 144831446 |
| Molecular Formula | C28H42N4O12 |
| Molecular Weight | 626.66 g/mol |
| Exact Mass | 626.28 |
| IUPAC Name | (2S,4S,6S)-6-[2-[3-[[2-amino-6-[(3-hydroxy-2,2-dimethylpropanoyl)amino]hexanoyl]amino]propanoylamino]-4-(carboxyoxymethyl)phenoxy]-4-hydroxyoxane-2-carboxylic acid |
| SMILES | CC(C)(CO)C(=O)NCCCCC(N)C(=O)NCCC(=O)Nc1cc(COC(=O)O)ccc1O[C@H]1C[C@@H](O)C[C@@H](C(=O)O)O1 |
| InChI | InChI=1S/C28H42N4O12/c1-28(2,15-33)26(39)31-9-4-3-5-18(29)24(36)30-10-8-22(35)32-19-11-16(14-42-27(40)41)6-7-20(19)43-23-13-17(34)12-21(44-23)25(37)38/h6-7,11,17-18,21,23,33-34H,3-5,8-10,12-15,29H2,1-2H3,(H,30,36)(H,31,39)(H,32,35)(H,37,38)(H,40,41)/t17-,18?,21-,23+/m0/s1 |
| InChIKey | BHCNNNLGXRTKNR-BKDSBTAWSA-N |
| XLogP | 0.29 |
| TPSA | 256.07 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.66 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|