C13H19NO10 — CID 118885717
[(2S,4S,5S)-4,5-diacetyloxy-3-(formyloxyamino)-6-hydroxyoxan-2-yl]methyl acetate (PubChem CID 118885717) has the molecular formula C13H19NO10 and a molecular weight of 349.29 g/mol. Its IUPAC name is [(2S,4S,5S)-4,5-diacetyloxy-3-(formyloxyamino)-6-hydroxyoxan-2-yl]methyl acetate.
| Compound Name | [(2S,4S,5S)-4,5-diacetyloxy-3-(formyloxyamino)-6-hydroxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 118885717 |
| Molecular Formula | C13H19NO10 |
| Molecular Weight | 349.29 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | [(2S,4S,5S)-4,5-diacetyloxy-3-(formyloxyamino)-6-hydroxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1OC(O)[C@@H](OC(C)=O)[C@@H](OC(C)=O)C1NOC=O |
| InChI | InChI=1S/C13H19NO10/c1-6(16)20-4-9-10(14-21-5-15)11(22-7(2)17)12(13(19)24-9)23-8(3)18/h5,9-14,19H,4H2,1-3H3/t9-,10?,11+,12+,13?/m1/s1 |
| InChIKey | WQLFYIJPVIXRJJ-SZMZNBQVSA-N |
| XLogP | -1.82 |
| TPSA | 146.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.29 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|