C31H31BrO5S — CID 73041952
S-[[6-(2-bromoethynyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl] ethanethioate (PubChem CID 73041952) has the molecular formula C31H31BrO5S and a molecular weight of 595.56 g/mol. Its IUPAC name is S-[[6-(2-bromoethynyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl] ethanethioate.
| Compound Name | S-[[6-(2-bromoethynyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl] ethanethioate |
|---|---|
| PubChem CID | 73041952 |
| Molecular Formula | C31H31BrO5S |
| Molecular Weight | 595.56 g/mol |
| Exact Mass | 594.11 |
| IUPAC Name | S-[[6-(2-bromoethynyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl] ethanethioate |
| SMILES | CC(=O)SCC1OC(C#CBr)C(OCc2ccccc2)C(OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C31H31BrO5S/c1-23(33)38-22-28-30(35-20-25-13-7-3-8-14-25)31(36-21-26-15-9-4-10-16-26)29(27(37-28)17-18-32)34-19-24-11-5-2-6-12-24/h2-16,27-31H,19-22H2,1H3 |
| InChIKey | VHVXHWOPRSYHLN-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.56 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|