C54H54N2O9 — CID 11182087
methyl (2S)-2-(phenylmethoxycarbonylamino)-3-[2-[(2R,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]-1H-indol-3-yl]propanoate (PubChem CID 11182087) has the molecular formula C54H54N2O9 and a molecular weight of 875.03 g/mol. Its IUPAC name is methyl (2S)-2-(phenylmethoxycarbonylamino)-3-[2-[(2R,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]-1H-indol-3-yl]propanoate.
| Compound Name | methyl (2S)-2-(phenylmethoxycarbonylamino)-3-[2-[(2R,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]-1H-indol-3-yl]propanoate |
|---|---|
| PubChem CID | 11182087 |
| Molecular Formula | C54H54N2O9 |
| Molecular Weight | 875.03 g/mol |
| Exact Mass | 874.38 |
| IUPAC Name | methyl (2S)-2-(phenylmethoxycarbonylamino)-3-[2-[(2R,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]-1H-indol-3-yl]propanoate |
| SMILES | COC(=O)[C@H](Cc1c([C@H]2O[C@H](COCc3ccccc3)[C@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]2OCc2ccccc2)[nH]c2ccccc12)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C54H54N2O9/c1-59-53(57)46(56-54(58)64-36-42-27-15-6-16-28-42)31-44-43-29-17-18-30-45(43)55-48(44)50-52(63-35-41-25-13-5-14-26-41)51(62-34-40-23-11-4-12-24-40)49(61-33-39-21-9-3-10-22-39)47(65-50)37-60-32-38-19-7-2-8-20-38/h2-30,46-47,49-52,55H,31-37H2,1H3,(H,56,58)/t46-,47+,49-,50+,51-,52-/m0/s1 |
| InChIKey | WKLZAXPRZHDNAN-XDNMIKEDSA-N |
| XLogP | 9.59 |
| TPSA | 126.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 875.03 |
| LogP ≤ 5 | 9.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |