C47H54O7S — CID 101211296
(2S,3R,4S,5R,6R)-2-[(2S)-2-methoxy-3-methyl-3-(4-methylphenyl)sulfanylbutyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ol (PubChem CID 101211296) has the molecular formula C47H54O7S and a molecular weight of 763.01 g/mol. Its IUPAC name is (2S,3R,4S,5R,6R)-2-[(2S)-2-methoxy-3-methyl-3-(4-methylphenyl)sulfanylbutyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ol.
| Compound Name | (2S,3R,4S,5R,6R)-2-[(2S)-2-methoxy-3-methyl-3-(4-methylphenyl)sulfanylbutyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ol |
|---|---|
| PubChem CID | 101211296 |
| Molecular Formula | C47H54O7S |
| Molecular Weight | 763.01 g/mol |
| Exact Mass | 762.36 |
| IUPAC Name | (2S,3R,4S,5R,6R)-2-[(2S)-2-methoxy-3-methyl-3-(4-methylphenyl)sulfanylbutyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ol |
| SMILES | CO[C@@H](C[C@]1(O)O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1)C(C)(C)Sc1ccc(C)cc1 |
| InChI | InChI=1S/C47H54O7S/c1-35-25-27-40(28-26-35)55-46(2,3)42(49-4)29-47(48)45(53-33-39-23-15-8-16-24-39)44(52-32-38-21-13-7-14-22-38)43(51-31-37-19-11-6-12-20-37)41(54-47)34-50-30-36-17-9-5-10-18-36/h5-28,41-45,48H,29-34H2,1-4H3/t41-,42+,43-,44+,45-,47+/m1/s1 |
| InChIKey | IVGANRIMLWWOIK-IULMFEESSA-N |
| XLogP | 9.33 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.01 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |