C48H59NO9 — CID 146031167
tert-butyl N-[(E,1S)-1-[(4S,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]-3-[(2S,4R,5S)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]prop-2-enyl]carbamate (PubChem CID 146031167) has the molecular formula C48H59NO9 and a molecular weight of 794.00 g/mol. Its IUPAC name is tert-butyl N-[(E,1S)-1-[(4S,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]-3-[(2S,4R,5S)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]prop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[(E,1S)-1-[(4S,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]-3-[(2S,4R,5S)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 146031167 |
| Molecular Formula | C48H59NO9 |
| Molecular Weight | 794.00 g/mol |
| Exact Mass | 793.42 |
| IUPAC Name | tert-butyl N-[(E,1S)-1-[(4S,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]-3-[(2S,4R,5S)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]prop-2-enyl]carbamate |
| SMILES | C[C@H]1OC(C)(C)O[C@H]1[C@H](/C=C/[C@@H]1OC(COCc2ccccc2)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)C1OCc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C48H59NO9/c1-34-42(57-48(5,6)56-34)39(49-46(50)58-47(2,3)4)27-28-40-43(52-30-36-21-13-8-14-22-36)45(54-32-38-25-17-10-18-26-38)44(53-31-37-23-15-9-16-24-37)41(55-40)33-51-29-35-19-11-7-12-20-35/h7-28,34,39-45H,29-33H2,1-6H3,(H,49,50)/b28-27+/t34-,39+,40+,41?,42-,43?,44+,45-/m1/s1 |
| InChIKey | OEADBMQEMVAJHR-XTAMGBLHSA-N |
| XLogP | 8.72 |
| TPSA | 102.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.00 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|