C20H31NO4 — CID 138969655
tert-butyl N-[(1R)-3-methyl-1-[(2S,3S)-3-(phenylmethoxymethyl)oxiran-2-yl]butyl]carbamate (PubChem CID 138969655) has the molecular formula C20H31NO4 and a molecular weight of 349.47 g/mol. Its IUPAC name is tert-butyl N-[(1R)-3-methyl-1-[(2S,3S)-3-(phenylmethoxymethyl)oxiran-2-yl]butyl]carbamate.
| Compound Name | tert-butyl N-[(1R)-3-methyl-1-[(2S,3S)-3-(phenylmethoxymethyl)oxiran-2-yl]butyl]carbamate |
|---|---|
| PubChem CID | 138969655 |
| Molecular Formula | C20H31NO4 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.23 |
| IUPAC Name | tert-butyl N-[(1R)-3-methyl-1-[(2S,3S)-3-(phenylmethoxymethyl)oxiran-2-yl]butyl]carbamate |
| SMILES | CC(C)C[C@@H](NC(=O)OC(C)(C)C)[C@@H]1O[C@H]1COCc1ccccc1 |
| InChI | InChI=1S/C20H31NO4/c1-14(2)11-16(21-19(22)25-20(3,4)5)18-17(24-18)13-23-12-15-9-7-6-8-10-15/h6-10,14,16-18H,11-13H2,1-5H3,(H,21,22)/t16-,17+,18+/m1/s1 |
| InChIKey | LOIOFXKRROOTEW-SQNIBIBYSA-N |
| XLogP | 3.91 |
| TPSA | 60.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|