C19H29NO4 — CID 135049682
tert-butyl N-[2-methyl-1-[(2R,3S)-3-(phenylmethoxymethyl)oxiran-2-yl]propyl]carbamate (PubChem CID 135049682) has the molecular formula C19H29NO4 and a molecular weight of 335.44 g/mol. Its IUPAC name is tert-butyl N-[2-methyl-1-[(2R,3S)-3-(phenylmethoxymethyl)oxiran-2-yl]propyl]carbamate.
| Compound Name | tert-butyl N-[2-methyl-1-[(2R,3S)-3-(phenylmethoxymethyl)oxiran-2-yl]propyl]carbamate |
|---|---|
| PubChem CID | 135049682 |
| Molecular Formula | C19H29NO4 |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | tert-butyl N-[2-methyl-1-[(2R,3S)-3-(phenylmethoxymethyl)oxiran-2-yl]propyl]carbamate |
| SMILES | CC(C)C(NC(=O)OC(C)(C)C)[C@H]1O[C@H]1COCc1ccccc1 |
| InChI | InChI=1S/C19H29NO4/c1-13(2)16(20-18(21)24-19(3,4)5)17-15(23-17)12-22-11-14-9-7-6-8-10-14/h6-10,13,15-17H,11-12H2,1-5H3,(H,20,21)/t15-,16?,17-/m0/s1 |
| InChIKey | GCTPRMFIDWUBQB-QRFGZVGRSA-N |
| XLogP | 3.52 |
| TPSA | 60.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|