C15H21NO4 — CID 139650639
benzyl N-[(1S)-1-[(2R,3S)-3-(hydroxymethyl)oxiran-2-yl]-2-methylpropyl]carbamate (PubChem CID 139650639) has the molecular formula C15H21NO4 and a molecular weight of 279.34 g/mol. Its IUPAC name is benzyl N-[(1S)-1-[(2R,3S)-3-(hydroxymethyl)oxiran-2-yl]-2-methylpropyl]carbamate.
| Compound Name | benzyl N-[(1S)-1-[(2R,3S)-3-(hydroxymethyl)oxiran-2-yl]-2-methylpropyl]carbamate |
|---|---|
| PubChem CID | 139650639 |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | benzyl N-[(1S)-1-[(2R,3S)-3-(hydroxymethyl)oxiran-2-yl]-2-methylpropyl]carbamate |
| SMILES | CC(C)[C@H](NC(=O)OCc1ccccc1)[C@H]1O[C@H]1CO |
| InChI | InChI=1S/C15H21NO4/c1-10(2)13(14-12(8-17)20-14)16-15(18)19-9-11-6-4-3-5-7-11/h3-7,10,12-14,17H,8-9H2,1-2H3,(H,16,18)/t12-,13-,14-/m0/s1 |
| InChIKey | SAUAGVDDQJPZOX-IHRRRGAJSA-N |
| XLogP | 1.70 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|