C23H35NO7Si — CID 11305832
1-O-benzyl 6-O-(2-trimethylsilylethyl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxohexanedioate (PubChem CID 11305832) has the molecular formula C23H35NO7Si and a molecular weight of 465.62 g/mol. Its IUPAC name is 1-O-benzyl 6-O-(2-trimethylsilylethyl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxohexanedioate.
| Compound Name | 1-O-benzyl 6-O-(2-trimethylsilylethyl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxohexanedioate |
|---|---|
| PubChem CID | 11305832 |
| Molecular Formula | C23H35NO7Si |
| Molecular Weight | 465.62 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | 1-O-benzyl 6-O-(2-trimethylsilylethyl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxohexanedioate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC(=O)CC(=O)OCC[Si](C)(C)C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H35NO7Si/c1-23(2,3)31-22(28)24-19(21(27)30-16-17-10-8-7-9-11-17)14-18(25)15-20(26)29-12-13-32(4,5)6/h7-11,19H,12-16H2,1-6H3,(H,24,28)/t19-/m0/s1 |
| InChIKey | SEMGEYFUDRVKFN-IBGZPJMESA-N |
| XLogP | 3.85 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.62 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|