C39H52N2O9Si — CID 91530402
benzyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-[3-[(2S)-3-oxo-2-(phenylmethoxycarbonylamino)-3-(2-trimethylsilylethoxy)propyl]phenoxy]pentanoate (PubChem CID 91530402) has the molecular formula C39H52N2O9Si and a molecular weight of 720.94 g/mol. Its IUPAC name is benzyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-[3-[(2S)-3-oxo-2-(phenylmethoxycarbonylamino)-3-(2-trimethylsilylethoxy)propyl]phenoxy]pentanoate.
| Compound Name | benzyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-[3-[(2S)-3-oxo-2-(phenylmethoxycarbonylamino)-3-(2-trimethylsilylethoxy)propyl]phenoxy]pentanoate |
|---|---|
| PubChem CID | 91530402 |
| Molecular Formula | C39H52N2O9Si |
| Molecular Weight | 720.94 g/mol |
| Exact Mass | 720.34 |
| IUPAC Name | benzyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-[3-[(2S)-3-oxo-2-(phenylmethoxycarbonylamino)-3-(2-trimethylsilylethoxy)propyl]phenoxy]pentanoate |
| SMILES | CC(C)(C)OC(=O)N[C@H](CCCOc1cccc(C[C@H](NC(=O)OCc2ccccc2)C(=O)OCC[Si](C)(C)C)c1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C39H52N2O9Si/c1-39(2,3)50-38(45)40-33(35(42)48-27-29-15-9-7-10-16-29)21-14-22-46-32-20-13-19-31(25-32)26-34(36(43)47-23-24-51(4,5)6)41-37(44)49-28-30-17-11-8-12-18-30/h7-13,15-20,25,33-34H,14,21-24,26-28H2,1-6H3,(H,40,45)(H,41,44)/t33-,34+/m1/s1 |
| InChIKey | NZIHQHDXZSZHDN-NOCHOARKSA-N |
| XLogP | 7.20 |
| TPSA | 138.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.94 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|