C31H44N2O9Si — CID 69387677
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-[3-[(2S)-3-oxo-2-(phenylmethoxycarbonylamino)-3-(2-trimethylsilylethoxy)propyl]phenoxy]butanoic acid (PubChem CID 69387677) has the molecular formula C31H44N2O9Si and a molecular weight of 616.78 g/mol. Its IUPAC name is (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-[3-[(2S)-3-oxo-2-(phenylmethoxycarbonylamino)-3-(2-trimethylsilylethoxy)propyl]phenoxy]butanoic acid.
| Compound Name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-[3-[(2S)-3-oxo-2-(phenylmethoxycarbonylamino)-3-(2-trimethylsilylethoxy)propyl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 69387677 |
| Molecular Formula | C31H44N2O9Si |
| Molecular Weight | 616.78 g/mol |
| Exact Mass | 616.28 |
| IUPAC Name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-[3-[(2S)-3-oxo-2-(phenylmethoxycarbonylamino)-3-(2-trimethylsilylethoxy)propyl]phenoxy]butanoic acid |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCOc1cccc(C[C@H](NC(=O)OCc2ccccc2)C(=O)OCC[Si](C)(C)C)c1)C(=O)O |
| InChI | InChI=1S/C31H44N2O9Si/c1-31(2,3)42-30(38)32-25(27(34)35)15-16-39-24-14-10-13-23(19-24)20-26(28(36)40-17-18-43(4,5)6)33-29(37)41-21-22-11-8-7-9-12-22/h7-14,19,25-26H,15-18,20-21H2,1-6H3,(H,32,38)(H,33,37)(H,34,35)/t25-,26-/m0/s1 |
| InChIKey | HDYSQFGBCGPLJW-UIOOFZCWSA-N |
| XLogP | 5.15 |
| TPSA | 149.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.78 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|