C32H46N2O9Si — CID 69385572
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-[3-[(2S)-3-oxo-2-(phenylmethoxycarbonylamino)-3-(2-trimethylsilylethoxy)propyl]phenoxy]pentanoic acid (PubChem CID 69385572) has the molecular formula C32H46N2O9Si and a molecular weight of 630.81 g/mol. Its IUPAC name is (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-[3-[(2S)-3-oxo-2-(phenylmethoxycarbonylamino)-3-(2-trimethylsilylethoxy)propyl]phenoxy]pentanoic acid.
| Compound Name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-[3-[(2S)-3-oxo-2-(phenylmethoxycarbonylamino)-3-(2-trimethylsilylethoxy)propyl]phenoxy]pentanoic acid |
|---|---|
| PubChem CID | 69385572 |
| Molecular Formula | C32H46N2O9Si |
| Molecular Weight | 630.81 g/mol |
| Exact Mass | 630.30 |
| IUPAC Name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-[3-[(2S)-3-oxo-2-(phenylmethoxycarbonylamino)-3-(2-trimethylsilylethoxy)propyl]phenoxy]pentanoic acid |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCCOc1cccc(C[C@H](NC(=O)OCc2ccccc2)C(=O)OCC[Si](C)(C)C)c1)C(=O)O |
| InChI | InChI=1S/C32H46N2O9Si/c1-32(2,3)43-31(39)33-26(28(35)36)16-11-17-40-25-15-10-14-24(20-25)21-27(29(37)41-18-19-44(4,5)6)34-30(38)42-22-23-12-8-7-9-13-23/h7-10,12-15,20,26-27H,11,16-19,21-22H2,1-6H3,(H,33,39)(H,34,38)(H,35,36)/t26-,27-/m0/s1 |
| InChIKey | HNUSENHAOSTFJC-SVBPBHIXSA-N |
| XLogP | 5.54 |
| TPSA | 149.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.81 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|